C18H18N4 — CID 11543843
8,8-diphenyl-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine (PubChem CID 11543843) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 8,8-diphenyl-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine.
| Compound Name | 8,8-diphenyl-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 11543843 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 8,8-diphenyl-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C2=NCCCN12 |
| InChI | InChI=1S/C18H18N4/c19-17-21-18(14-8-3-1-4-9-14,15-10-5-2-6-11-15)16-20-12-7-13-22(16)17/h1-6,8-11H,7,12-13H2,(H2,19,21) |
| InChIKey | UFWSJOVQEPTPNE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |