C12H15N5O2 — CID 115440117
[4-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-yl]methanamine (PubChem CID 115440117) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is [4-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-yl]methanamine.
| Compound Name | [4-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 115440117 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [4-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-yl]methanamine |
| SMILES | NCC1(c2nc(-c3cnccn3)no2)CCOCC1 |
| InChI | InChI=1S/C12H15N5O2/c13-8-12(1-5-18-6-2-12)11-16-10(17-19-11)9-7-14-3-4-15-9/h3-4,7H,1-2,5-6,8,13H2 |
| InChIKey | WXXDCCFGILKCRT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |