C13H8ClF2N5 — CID 11544050
15-chloro-5-(difluoromethyl)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 11544050) has the molecular formula C13H8ClF2N5 and a molecular weight of 307.69 g/mol. Its IUPAC name is 15-chloro-5-(difluoromethyl)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-chloro-5-(difluoromethyl)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 11544050 |
| Molecular Formula | C13H8ClF2N5 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 15-chloro-5-(difluoromethyl)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | FC(F)c1ncn2c1Cn1ncnc1-c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C13H8ClF2N5/c14-7-1-2-9-8(3-7)13-17-5-19-21(13)4-10-11(12(15)16)18-6-20(9)10/h1-3,5-6,12H,4H2 |
| InChIKey | KBFYDAGNYWSKLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |