C11H25ClNO5P — CID 11544233
(2S,3S,4R,5S)-2-(2-diethoxyphosphorylethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride (PubChem CID 11544233) has the molecular formula C11H25ClNO5P and a molecular weight of 317.75 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-(2-diethoxyphosphorylethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride.
| Compound Name | (2S,3S,4R,5S)-2-(2-diethoxyphosphorylethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 11544233 |
| Molecular Formula | C11H25ClNO5P |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2S,3S,4R,5S)-2-(2-diethoxyphosphorylethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
| SMILES | CCOP(=O)(CC[C@@H]1N[C@@H](C)[C@@H](O)[C@H]1O)OCC.Cl |
| InChI | InChI=1S/C11H24NO5P.ClH/c1-4-16-18(15,17-5-2)7-6-9-11(14)10(13)8(3)12-9;/h8-14H,4-7H2,1-3H3;1H/t8-,9-,10+,11-;/m0./s1 |
| InChIKey | WQMRGPCTUHMXNB-CWXCEVAHSA-N |
| XLogP | 1.15 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|