C16H11FN6O — CID 11544306
1-(4-fluorophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea (PubChem CID 11544306) has the molecular formula C16H11FN6O and a molecular weight of 322.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea |
|---|---|
| PubChem CID | 11544306 |
| Molecular Formula | C16H11FN6O |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ncnc2nn3ccccc3c12 |
| InChI | InChI=1S/C16H11FN6O/c17-10-4-6-11(7-5-10)20-16(24)21-14-13-12-3-1-2-8-23(12)22-15(13)19-9-18-14/h1-9H,(H2,18,19,20,21,22,24) |
| InChIKey | VXNUSJMWECFYQW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |