About [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine
[1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine (PubChem CID 115443687) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine.
Molecular Properties
| Compound Name | [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine |
| PubChem CID | 115443687 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine |
| SMILES | Cn1c(C2(CN)CCCCCC2)nc2cnccc21 |
| InChI | InChI=1S/C15H22N4/c1-19-13-6-9-17-10-12(13)18-14(19)15(11-16)7-4-2-3-5-8-15/h6,9-10H,2-5,7-8,11,16H2,1H3 |
| InChIKey | XIZHWJKWAVKOON-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine?
The IUPAC name of [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine (CID 115443687) is [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine.
What is the SMILES notation for [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine?
The canonical SMILES for [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine is Cn1c(C2(CN)CCCCCC2)nc2cnccc21.
What is the InChIKey of [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine?
The InChIKey is XIZHWJKWAVKOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-19-13-6-9-17-10-12(13)18-14(19)15(11-16)7-4-2-3-5-8-15/h6,9-10H,2-5,7-8,11,16H2,1H3.
What are the key properties of [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine?
[1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine has a molecular weight of 258.37 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-methylimidazo[4,5-c]pyridin-2-yl)cycloheptyl]methanamine is sourced from PubChem (CID 115443687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).