C15H20Br2N2O — CID 115443809
1-(aminomethyl)-N-(2,4-dibromophenyl)cycloheptane-1-carboxamide (PubChem CID 115443809) has the molecular formula C15H20Br2N2O and a molecular weight of 404.15 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2,4-dibromophenyl)cycloheptane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(2,4-dibromophenyl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 115443809 |
| Molecular Formula | C15H20Br2N2O |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 1-(aminomethyl)-N-(2,4-dibromophenyl)cycloheptane-1-carboxamide |
| SMILES | NCC1(C(=O)Nc2ccc(Br)cc2Br)CCCCCC1 |
| InChI | InChI=1S/C15H20Br2N2O/c16-11-5-6-13(12(17)9-11)19-14(20)15(10-18)7-3-1-2-4-8-15/h5-6,9H,1-4,7-8,10,18H2,(H,19,20) |
| InChIKey | TYXAFNHGEZUVOO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |