methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate

C16H12BrNO2 — CID 11544470

IUPACmethyl 5-bromobenzo[b][1]benzazepine-11-carboxylate
SMILESCOC(=O)N1c2ccccc2C=C(Br)c2ccccc21
InChIInChI=1S/C16H12BrNO2/c1-20-16(19)18-14-8-4-2-6-11(14)10-13(17)12-7-3-5-9-15(12)18/h2-10H,1H3
InChIKeyDUBDUARLAMXTNG-UHFFFAOYSA-N
MW330.18 g/mol
LogP4.80
Rot. Bonds

About methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate

methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate (PubChem CID 11544470) has the molecular formula C16H12BrNO2 and a molecular weight of 330.18 g/mol. Its IUPAC name is methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate.

Molecular Properties

Compound Namemethyl 5-bromobenzo[b][1]benzazepine-11-carboxylate
PubChem CID11544470
Molecular FormulaC16H12BrNO2
Molecular Weight330.18 g/mol
Exact Mass329.01
IUPAC Namemethyl 5-bromobenzo[b][1]benzazepine-11-carboxylate
SMILESCOC(=O)N1c2ccccc2C=C(Br)c2ccccc21
InChIInChI=1S/C16H12BrNO2/c1-20-16(19)18-14-8-4-2-6-11(14)10-13(17)12-7-3-5-9-15(12)18/h2-10H,1H3
InChIKeyDUBDUARLAMXTNG-UHFFFAOYSA-N
XLogP4.80
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.18
LogP ≤ 54.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate?
The IUPAC name of methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate (CID 11544470) is methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate.
What is the SMILES notation for methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate?
The canonical SMILES for methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate is COC(=O)N1c2ccccc2C=C(Br)c2ccccc21.
What is the InChIKey of methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate?
The InChIKey is DUBDUARLAMXTNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNO2/c1-20-16(19)18-14-8-4-2-6-11(14)10-13(17)12-7-3-5-9-15(12)18/h2-10H,1H3.
What are the key properties of methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate?
methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate has a molecular weight of 330.18 g/mol, XLogP of 4.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromobenzo[b][1]benzazepine-11-carboxylate is sourced from PubChem (CID 11544470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).