C15H16N2O3 — CID 115445167
1-[(1H-indole-3-carbonylamino)methyl]cyclobutane-1-carboxylic acid (PubChem CID 115445167) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[(1H-indole-3-carbonylamino)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(1H-indole-3-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115445167 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[(1H-indole-3-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H16N2O3/c18-13(17-9-15(14(19)20)6-3-7-15)11-8-16-12-5-2-1-4-10(11)12/h1-2,4-5,8,16H,3,6-7,9H2,(H,17,18)(H,19,20) |
| InChIKey | DHXJTEXGBKMJAI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |