C21H34O3 — CID 11544545
(2S,3R,5R)-2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5-methoxyoxolane-3-carbaldehyde (PubChem CID 11544545) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2S,3R,5R)-2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5-methoxyoxolane-3-carbaldehyde.
| Compound Name | (2S,3R,5R)-2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5-methoxyoxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 11544545 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2S,3R,5R)-2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-5-methoxyoxolane-3-carbaldehyde |
| SMILES | C=C1CC[C@@H]2C(C)(C)CCC[C@@]2(C)[C@@H]1C[C@@H]1O[C@@H](OC)C[C@H]1C=O |
| InChI | InChI=1S/C21H34O3/c1-14-7-8-18-20(2,3)9-6-10-21(18,4)16(14)12-17-15(13-22)11-19(23-5)24-17/h13,15-19H,1,6-12H2,2-5H3/t15-,16+,17-,18+,19+,21-/m0/s1 |
| InChIKey | NVAZXGMNDVSPQO-PRRWTPNDSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|