About 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione
9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione (PubChem CID 11544552) has the molecular formula C15H11BrO4
and a molecular weight of 335.15 g/mol. Its IUPAC name is 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione.
Molecular Properties
| Compound Name | 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione |
| PubChem CID | 11544552 |
| Molecular Formula | C15H11BrO4 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione |
| SMILES | CC1(C)C=Cc2c(ccc3c2C(=O)C(Br)C(=O)C3=O)O1 |
| InChI | InChI=1S/C15H11BrO4/c1-15(2)6-5-7-9(20-15)4-3-8-10(7)13(18)11(16)14(19)12(8)17/h3-6,11H,1-2H3 |
| InChIKey | MBZJHLBKRYHZSE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione?
The IUPAC name of 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione (CID 11544552) is 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione.
What is the SMILES notation for 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione?
The canonical SMILES for 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione is CC1(C)C=Cc2c(ccc3c2C(=O)C(Br)C(=O)C3=O)O1.
What is the InChIKey of 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione?
The InChIKey is MBZJHLBKRYHZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO4/c1-15(2)6-5-7-9(20-15)4-3-8-10(7)13(18)11(16)14(19)12(8)17/h3-6,11H,1-2H3.
What are the key properties of 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione?
9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione has a molecular weight of 335.15 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-3,3-dimethylbenzo[f]chromene-7,8,10-trione is sourced from PubChem (CID 11544552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).