C13H8N2O7S — CID 11544568
2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid (PubChem CID 11544568) has the molecular formula C13H8N2O7S and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid.
| Compound Name | 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 11544568 |
| Molecular Formula | C13H8N2O7S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-(9-nitro-1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)c2c(ccc3cccc([N+](=O)[O-])c23)S1(=O)=O |
| InChI | InChI=1S/C13H8N2O7S/c16-10(17)6-14-13(18)12-9(23(14,21)22)5-4-7-2-1-3-8(11(7)12)15(19)20/h1-5H,6H2,(H,16,17) |
| InChIKey | BDGULYBVFQFDLL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|