C14H19N3 — CID 115445764
[1-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclobutyl]methanamine (PubChem CID 115445764) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is [1-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclobutyl]methanamine.
| Compound Name | [1-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 115445764 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | [1-(5,6-dimethyl-1H-benzimidazol-2-yl)cyclobutyl]methanamine |
| SMILES | Cc1cc2nc(C3(CN)CCC3)[nH]c2cc1C |
| InChI | InChI=1S/C14H19N3/c1-9-6-11-12(7-10(9)2)17-13(16-11)14(8-15)4-3-5-14/h6-7H,3-5,8,15H2,1-2H3,(H,16,17) |
| InChIKey | ZXBPQUAKKCXZHU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |