About [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine
[1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine (PubChem CID 115446195) has the molecular formula C12H13ClN2O
and a molecular weight of 236.70 g/mol. Its IUPAC name is [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine |
| PubChem CID | 115446195 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2nc3ccc(Cl)cc3o2)CCC1 |
| InChI | InChI=1S/C12H13ClN2O/c13-8-2-3-9-10(6-8)16-11(15-9)12(7-14)4-1-5-12/h2-3,6H,1,4-5,7,14H2 |
| InChIKey | PKQQURAENAVBEK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine?
The IUPAC name of [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine (CID 115446195) is [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine.
What is the SMILES notation for [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine?
The canonical SMILES for [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine is NCC1(c2nc3ccc(Cl)cc3o2)CCC1.
What is the InChIKey of [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine?
The InChIKey is PKQQURAENAVBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O/c13-8-2-3-9-10(6-8)16-11(15-9)12(7-14)4-1-5-12/h2-3,6H,1,4-5,7,14H2.
What are the key properties of [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine?
[1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine has a molecular weight of 236.70 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-chloro-1,3-benzoxazol-2-yl)cyclobutyl]methanamine is sourced from PubChem (CID 115446195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).