C15H21F3O3S — CID 11544620
[(1R,5R,6R,7S,10R)-10-methyl-7-propan-2-yl-4-tricyclo[4.4.0.01,5]dec-3-enyl] trifluoromethanesulfonate (PubChem CID 11544620) has the molecular formula C15H21F3O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is [(1R,5R,6R,7S,10R)-10-methyl-7-propan-2-yl-4-tricyclo[4.4.0.01,5]dec-3-enyl] trifluoromethanesulfonate.
| Compound Name | [(1R,5R,6R,7S,10R)-10-methyl-7-propan-2-yl-4-tricyclo[4.4.0.01,5]dec-3-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11544620 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(1R,5R,6R,7S,10R)-10-methyl-7-propan-2-yl-4-tricyclo[4.4.0.01,5]dec-3-enyl] trifluoromethanesulfonate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@@]23CC=C(OS(=O)(=O)C(F)(F)F)[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C15H21F3O3S/c1-8(2)10-5-4-9(3)14-7-6-11(13(14)12(10)14)21-22(19,20)15(16,17)18/h6,8-10,12-13H,4-5,7H2,1-3H3/t9-,10+,12-,13-,14-/m1/s1 |
| InChIKey | KKNCCUNMQKSHRH-BJKGOZRQSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|