C16H26N2O3 — CID 115446456
1-[(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)methyl]cyclobutane-1-carboxylic acid (PubChem CID 115446456) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115446456 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCC1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H26N2O3/c19-14(20)16(8-4-9-16)11-17-15(21)18-10-3-6-12-5-1-2-7-13(12)18/h12-13H,1-11H2,(H,17,21)(H,19,20) |
| InChIKey | PQBJWOIDTBLWFV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |