C11H17F3N2O4 — CID 115446838
1-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 115446838) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 1-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115446838 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NCCOCC(F)(F)F)NCC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C11H17F3N2O4/c12-11(13,14)7-20-5-4-15-9(19)16-6-10(8(17)18)2-1-3-10/h1-7H2,(H,17,18)(H2,15,16,19) |
| InChIKey | XFNNXTGOAPYYDO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|