About 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile
2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile (PubChem CID 11544727) has the molecular formula C15H10Cl2N6
and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile |
| PubChem CID | 11544727 |
| Molecular Formula | C15H10Cl2N6 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CNc1nnnn1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl2N6/c16-12-6-3-7-13(14(12)17)23-15(20-21-22-23)19-9-11-5-2-1-4-10(11)8-18/h1-7H,9H2,(H,19,20,22) |
| InChIKey | PMYRZDKDSIHDIU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile?
The IUPAC name of 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile (CID 11544727) is 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile.
What is the SMILES notation for 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile?
The canonical SMILES for 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile is N#Cc1ccccc1CNc1nnnn1-c1cccc(Cl)c1Cl.
What is the InChIKey of 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile?
The InChIKey is PMYRZDKDSIHDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N6/c16-12-6-3-7-13(14(12)17)23-15(20-21-22-23)19-9-11-5-2-1-4-10(11)8-18/h1-7H,9H2,(H,19,20,22).
What are the key properties of 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile?
2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile has a molecular weight of 345.19 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[1-(2,3-dichlorophenyl)tetrazol-5-yl]amino]methyl]benzonitrile is sourced from PubChem (CID 11544727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).