C16H15N3O4S — CID 11544731
N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11544731) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11544731 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cccc2c1Oc1ccc(C(=O)N=C(N)N)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C16H15N3O4S/c1-9-3-2-4-11-8-24(21,22)13-7-10(15(20)19-16(17)18)5-6-12(13)23-14(9)11/h2-7H,8H2,1H3,(H4,17,18,19,20) |
| InChIKey | WUAKVASKDLENMZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|