C12H16ClN3O3S — CID 115447750
1-(aminomethyl)-N-(2-chloro-5-sulfamoylphenyl)cyclobutane-1-carboxamide (PubChem CID 115447750) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2-chloro-5-sulfamoylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(2-chloro-5-sulfamoylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115447750 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-(aminomethyl)-N-(2-chloro-5-sulfamoylphenyl)cyclobutane-1-carboxamide |
| SMILES | NCC1(C(=O)Nc2cc(S(N)(=O)=O)ccc2Cl)CCC1 |
| InChI | InChI=1S/C12H16ClN3O3S/c13-9-3-2-8(20(15,18)19)6-10(9)16-11(17)12(7-14)4-1-5-12/h2-3,6H,1,4-5,7,14H2,(H,16,17)(H2,15,18,19) |
| InChIKey | BENRAYKALJRGOO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |