C13H16N2O3 — CID 115448247
2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]benzoic acid (PubChem CID 115448247) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 115448247 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]benzoic acid |
| SMILES | NCC1(C(=O)Nc2ccccc2C(=O)O)CCC1 |
| InChI | InChI=1S/C13H16N2O3/c14-8-13(6-3-7-13)12(18)15-10-5-2-1-4-9(10)11(16)17/h1-2,4-5H,3,6-8,14H2,(H,15,18)(H,16,17) |
| InChIKey | DTUWENZZGRCDEO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |