About 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione
8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 11544894) has the molecular formula C17H15FN6O2
and a molecular weight of 354.35 g/mol. Its IUPAC name is 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 11544894 |
| Molecular Formula | C17H15FN6O2 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cnn(Cc4cccc(F)c4)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C17H15FN6O2/c1-22-15-13(16(25)23(2)17(22)26)20-14(21-15)11-7-19-24(9-11)8-10-4-3-5-12(18)6-10/h3-7,9H,8H2,1-2H3,(H,20,21) |
| InChIKey | HDWMDKHMNFXXDV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione (CID 11544894) is 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(-c3cnn(Cc4cccc(F)c4)c3)nc2n(C)c1=O.
What is the InChIKey of 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is HDWMDKHMNFXXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN6O2/c1-22-15-13(16(25)23(2)17(22)26)20-14(21-15)11-7-19-24(9-11)8-10-4-3-5-12(18)6-10/h3-7,9H,8H2,1-2H3,(H,20,21).
What are the key properties of 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione?
8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 354.35 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 11544894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).