C11H19N3O3 — CID 115451548
1-[[[3-(aminomethyl)pyrrolidine-1-carbonyl]amino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 115451548) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[[[3-(aminomethyl)pyrrolidine-1-carbonyl]amino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[[3-(aminomethyl)pyrrolidine-1-carbonyl]amino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115451548 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[[[3-(aminomethyl)pyrrolidine-1-carbonyl]amino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | NCC1CCN(C(=O)NCC2(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C11H19N3O3/c12-5-8-1-4-14(6-8)10(17)13-7-11(2-3-11)9(15)16/h8H,1-7,12H2,(H,13,17)(H,15,16) |
| InChIKey | HRTFFYOINQNXMP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |