C6H8N2O2 — CID 115451832
5,7-diazaspiro[2.5]octane-6,8-dione (PubChem CID 115451832) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 5,7-diazaspiro[2.5]octane-6,8-dione.
| Compound Name | 5,7-diazaspiro[2.5]octane-6,8-dione |
|---|---|
| PubChem CID | 115451832 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 5,7-diazaspiro[2.5]octane-6,8-dione |
| SMILES | O=C1NCC2(CC2)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O2/c9-4-6(1-2-6)3-7-5(10)8-4/h1-3H2,(H2,7,8,9,10) |
| InChIKey | SOMBXRBIJFTVIY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |