C18H30NO5P — CID 11545206
2-hydroxy-2-oxo-5-(8-phenylmethoxyoctyl)-1,3,2λ5-dioxaphosphinan-5-amine (PubChem CID 11545206) has the molecular formula C18H30NO5P and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-hydroxy-2-oxo-5-(8-phenylmethoxyoctyl)-1,3,2λ5-dioxaphosphinan-5-amine.
| Compound Name | 2-hydroxy-2-oxo-5-(8-phenylmethoxyoctyl)-1,3,2λ5-dioxaphosphinan-5-amine |
|---|---|
| PubChem CID | 11545206 |
| Molecular Formula | C18H30NO5P |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-hydroxy-2-oxo-5-(8-phenylmethoxyoctyl)-1,3,2λ5-dioxaphosphinan-5-amine |
| SMILES | NC1(CCCCCCCCOCc2ccccc2)COP(=O)(O)OC1 |
| InChI | InChI=1S/C18H30NO5P/c19-18(15-23-25(20,21)24-16-18)12-8-3-1-2-4-9-13-22-14-17-10-6-5-7-11-17/h5-7,10-11H,1-4,8-9,12-16,19H2,(H,20,21) |
| InChIKey | XGJISEFIDGCXKI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|