C11H12FIN2 — CID 115452194
8-fluoro-7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopropane] (PubChem CID 115452194) has the molecular formula C11H12FIN2 and a molecular weight of 318.13 g/mol. Its IUPAC name is 8-fluoro-7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopropane].
| Compound Name | 8-fluoro-7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 115452194 |
| Molecular Formula | C11H12FIN2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 8-fluoro-7-iodospiro[1,2,4,5-tetrahydro-1,5-benzodiazepine-3,1'-cyclopropane] |
| SMILES | Fc1cc2c(cc1I)NCC1(CC1)CN2 |
| InChI | InChI=1S/C11H12FIN2/c12-7-3-9-10(4-8(7)13)15-6-11(1-2-11)5-14-9/h3-4,14-15H,1-2,5-6H2 |
| InChIKey | REBXASOVPMDGQS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|