C13H17N3O2 — CID 115453144
3-[[[1-(aminomethyl)cyclopropanecarbonyl]amino]methyl]benzamide (PubChem CID 115453144) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-[[[1-(aminomethyl)cyclopropanecarbonyl]amino]methyl]benzamide.
| Compound Name | 3-[[[1-(aminomethyl)cyclopropanecarbonyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 115453144 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-[[[1-(aminomethyl)cyclopropanecarbonyl]amino]methyl]benzamide |
| SMILES | NCC1(C(=O)NCc2cccc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C13H17N3O2/c14-8-13(4-5-13)12(18)16-7-9-2-1-3-10(6-9)11(15)17/h1-3,6H,4-5,7-8,14H2,(H2,15,17)(H,16,18) |
| InChIKey | LHIPJVMECGOEOD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |