About 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione
8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11545341) has the molecular formula C20H22N6O2
and a molecular weight of 378.44 g/mol. Its IUPAC name is 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| PubChem CID | 11545341 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(-c4ccccc4)c3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C20H22N6O2/c1-3-10-24-18-16(19(27)25(11-4-2)20(24)28)22-17(23-18)14-12-21-26(13-14)15-8-6-5-7-9-15/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,22,23) |
| InChIKey | XHAWSVGLZHETMF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The IUPAC name of 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione (CID 11545341) is 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione is CCCn1c(=O)c2[nH]c(-c3cnn(-c4ccccc4)c3)nc2n(CCC)c1=O.
What is the InChIKey of 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione?
The InChIKey is XHAWSVGLZHETMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6O2/c1-3-10-24-18-16(19(27)25(11-4-2)20(24)28)22-17(23-18)14-12-21-26(13-14)15-8-6-5-7-9-15/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,22,23).
What are the key properties of 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione?
8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione has a molecular weight of 378.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-phenylpyrazol-4-yl)-1,3-dipropyl-7H-purine-2,6-dione is sourced from PubChem (CID 11545341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).