C8H14N2O2 — CID 115453516
1-(aminomethyl)-N-(oxetan-3-yl)cyclopropane-1-carboxamide (PubChem CID 115453516) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(oxetan-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(oxetan-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115453516 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(aminomethyl)-N-(oxetan-3-yl)cyclopropane-1-carboxamide |
| SMILES | NCC1(C(=O)NC2COC2)CC1 |
| InChI | InChI=1S/C8H14N2O2/c9-5-8(1-2-8)7(11)10-6-3-12-4-6/h6H,1-5,9H2,(H,10,11) |
| InChIKey | CMZJZUILUSIDSC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |