C13H19NO2 — CID 115454338
4-[1-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]phenol (PubChem CID 115454338) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-[1-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]phenol.
| Compound Name | 4-[1-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 115454338 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-[1-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]phenol |
| SMILES | CC(NCC1(CO)CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-10(11-2-4-12(16)5-3-11)14-8-13(9-15)6-7-13/h2-5,10,14-16H,6-9H2,1H3 |
| InChIKey | IEGUJSJSXUOODL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |