C11H17NO3 — CID 115454702
1-(furan-2-yl)-2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethanol (PubChem CID 115454702) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethanol |
|---|---|
| PubChem CID | 115454702 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(furan-2-yl)-2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethanol |
| SMILES | OCC1(CNCC(O)c2ccco2)CC1 |
| InChI | InChI=1S/C11H17NO3/c13-8-11(3-4-11)7-12-6-9(14)10-2-1-5-15-10/h1-2,5,9,12-14H,3-4,6-8H2 |
| InChIKey | KAVMKBLKWDSZDY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |