C8H11NO2 — CID 115455293
N-[[1-(hydroxymethyl)cyclopropyl]methyl]prop-2-ynamide (PubChem CID 115455293) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopropyl]methyl]prop-2-ynamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopropyl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 115455293 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopropyl]methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCC1(CO)CC1 |
| InChI | InChI=1S/C8H11NO2/c1-2-7(11)9-5-8(6-10)3-4-8/h1,10H,3-6H2,(H,9,11) |
| InChIKey | WMGXVLMTRAMZTB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|