C13H15Cl2NO — CID 115455902
N-[[1-(chloromethyl)cyclopropyl]methyl]-2-(4-chlorophenyl)acetamide (PubChem CID 115455902) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 115455902 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCC1(CCl)CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c14-8-13(5-6-13)9-16-12(17)7-10-1-3-11(15)4-2-10/h1-4H,5-9H2,(H,16,17) |
| InChIKey | UIQUWTNMUHGIRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|