C13H20BrNO — CID 115456221
N-[[1-(bromomethyl)cyclopropyl]methyl]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 115456221) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopropyl]methyl]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | N-[[1-(bromomethyl)cyclopropyl]methyl]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 115456221 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopropyl]methyl]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(NCC1(CBr)CC1)C1C2CCCCC21 |
| InChI | InChI=1S/C13H20BrNO/c14-7-13(5-6-13)8-15-12(16)11-9-3-1-2-4-10(9)11/h9-11H,1-8H2,(H,15,16) |
| InChIKey | UFACMTVFMKOXHM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|