About (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate
(3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (PubChem CID 11545634) has the molecular formula C19H12ClF3N2O2
and a molecular weight of 392.76 g/mol. Its IUPAC name is (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
Molecular Properties
| Compound Name | (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| PubChem CID | 11545634 |
| Molecular Formula | C19H12ClF3N2O2 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate |
| SMILES | O=C(Oc1cccc(Cl)c1)c1ccccc1Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12ClF3N2O2/c20-12-4-3-5-14(10-12)27-18(26)15-6-1-2-7-16(15)25-13-8-9-24-17(11-13)19(21,22)23/h1-11H,(H,24,25) |
| InChIKey | ZQYISAAAUBFWMX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The IUPAC name of (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate (CID 11545634) is (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate.
What is the SMILES notation for (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The canonical SMILES for (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is O=C(Oc1cccc(Cl)c1)c1ccccc1Nc1ccnc(C(F)(F)F)c1.
What is the InChIKey of (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
The InChIKey is ZQYISAAAUBFWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClF3N2O2/c20-12-4-3-5-14(10-12)27-18(26)15-6-1-2-7-16(15)25-13-8-9-24-17(11-13)19(21,22)23/h1-11H,(H,24,25).
What are the key properties of (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate?
(3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate has a molecular weight of 392.76 g/mol, XLogP of 5.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) 2-[[2-(trifluoromethyl)-4-pyridinyl]amino]benzoate is sourced from PubChem (CID 11545634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).