C14H20F6N2O4 — CID 11545653
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 11545653) has the molecular formula C14H20F6N2O4 and a molecular weight of 394.31 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 11545653 |
| Molecular Formula | C14H20F6N2O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)OCCCNC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H20F6N2O4/c1-11(2,3)25-6-4-5-21-10(23)8-7-9(26-22-8)12(24,13(15,16)17)14(18,19)20/h9,24H,4-7H2,1-3H3,(H,21,23) |
| InChIKey | GOGPBPSRUPJVIT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|