C23H19FN4O2 — CID 11545848
3-[4-[(3-fluoro-4-methylphenyl)carbamoylamino]phenyl]-1H-indole-2-carboxamide (PubChem CID 11545848) has the molecular formula C23H19FN4O2 and a molecular weight of 402.43 g/mol. Its IUPAC name is 3-[4-[(3-fluoro-4-methylphenyl)carbamoylamino]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[4-[(3-fluoro-4-methylphenyl)carbamoylamino]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11545848 |
| Molecular Formula | C23H19FN4O2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-[4-[(3-fluoro-4-methylphenyl)carbamoylamino]phenyl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3c(C(N)=O)[nH]c4ccccc34)cc2)cc1F |
| InChI | InChI=1S/C23H19FN4O2/c1-13-6-9-16(12-18(13)24)27-23(30)26-15-10-7-14(8-11-15)20-17-4-2-3-5-19(17)28-21(20)22(25)29/h2-12,28H,1H3,(H2,25,29)(H2,26,27,30) |
| InChIKey | BVFPAZNGNUKGQO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |