C14H19N5O — CID 115460197
2-[4-(aminomethyl)triazol-1-yl]-N-[(1R)-1-(3-methylphenyl)ethyl]acetamide (PubChem CID 115460197) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-[(1R)-1-(3-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(1R)-1-(3-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 115460197 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(1R)-1-(3-methylphenyl)ethyl]acetamide |
| SMILES | Cc1cccc([C@@H](C)NC(=O)Cn2cc(CN)nn2)c1 |
| InChI | InChI=1S/C14H19N5O/c1-10-4-3-5-12(6-10)11(2)16-14(20)9-19-8-13(7-15)17-18-19/h3-6,8,11H,7,9,15H2,1-2H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | AIRJFAKTBVYBCA-LLVKDONJSA-N |
| XLogP | 0.92 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |