C13H21N5O3 — CID 115460265
1-[[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 115460265) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115460265 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-[[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | NCc1cn(CC(=O)NCC2(C(=O)O)CCCCC2)nn1 |
| InChI | InChI=1S/C13H21N5O3/c14-6-10-7-18(17-16-10)8-11(19)15-9-13(12(20)21)4-2-1-3-5-13/h7H,1-6,8-9,14H2,(H,15,19)(H,20,21) |
| InChIKey | LFYJKMBYASVTAF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |