C16H16BrNO3 — CID 115460531
2-[2-[(2-amino-4-bromo-6-methylphenoxy)methyl]phenyl]acetic acid (PubChem CID 115460531) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-[2-[(2-amino-4-bromo-6-methylphenoxy)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(2-amino-4-bromo-6-methylphenoxy)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115460531 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[2-[(2-amino-4-bromo-6-methylphenoxy)methyl]phenyl]acetic acid |
| SMILES | Cc1cc(Br)cc(N)c1OCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C16H16BrNO3/c1-10-6-13(17)8-14(18)16(10)21-9-12-5-3-2-4-11(12)7-15(19)20/h2-6,8H,7,9,18H2,1H3,(H,19,20) |
| InChIKey | HVZRFIIXLZDZJV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|