C21H16F3N5O — CID 11546054
N-methyl-4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-2-yl]amino]benzamide (PubChem CID 11546054) has the molecular formula C21H16F3N5O and a molecular weight of 411.39 g/mol. Its IUPAC name is N-methyl-4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-2-yl]amino]benzamide.
| Compound Name | N-methyl-4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 11546054 |
| Molecular Formula | C21H16F3N5O |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-methyl-4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]quinolin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1ccc(Nc2cc(-n3ccc(C(F)(F)F)n3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H16F3N5O/c1-25-20(30)13-6-8-14(9-7-13)26-19-12-17(15-4-2-3-5-16(15)27-19)29-11-10-18(28-29)21(22,23)24/h2-12H,1H3,(H,25,30)(H,26,27) |
| InChIKey | BNUKECGGXNIERD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |