C16H12ClNO3 — CID 115460814
2-[2-[(5-chloro-2-cyanophenoxy)methyl]phenyl]acetic acid (PubChem CID 115460814) has the molecular formula C16H12ClNO3 and a molecular weight of 301.73 g/mol. Its IUPAC name is 2-[2-[(5-chloro-2-cyanophenoxy)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(5-chloro-2-cyanophenoxy)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115460814 |
| Molecular Formula | C16H12ClNO3 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[2-[(5-chloro-2-cyanophenoxy)methyl]phenyl]acetic acid |
| SMILES | N#Cc1ccc(Cl)cc1OCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C16H12ClNO3/c17-14-6-5-12(9-18)15(8-14)21-10-13-4-2-1-3-11(13)7-16(19)20/h1-6,8H,7,10H2,(H,19,20) |
| InChIKey | XIYXMXSTJXGJRT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |