C15H14FNO2 — CID 115461455
2-[2-[(3-fluoroanilino)methyl]phenyl]acetic acid (PubChem CID 115461455) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[2-[(3-fluoroanilino)methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(3-fluoroanilino)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115461455 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[2-[(3-fluoroanilino)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1CNc1cccc(F)c1 |
| InChI | InChI=1S/C15H14FNO2/c16-13-6-3-7-14(9-13)17-10-12-5-2-1-4-11(12)8-15(18)19/h1-7,9,17H,8,10H2,(H,18,19) |
| InChIKey | WNYWPWHAASNPCU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |