C22H27NO7 — CID 11546193
tert-butyl 3-[2-[(2R,3S)-4-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]azetidin-2-yl]acetyl]benzoate (PubChem CID 11546193) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2R,3S)-4-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]azetidin-2-yl]acetyl]benzoate.
| Compound Name | tert-butyl 3-[2-[(2R,3S)-4-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]azetidin-2-yl]acetyl]benzoate |
|---|---|
| PubChem CID | 11546193 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl 3-[2-[(2R,3S)-4-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]azetidin-2-yl]acetyl]benzoate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N[C@@H]1CC(=O)c1cccc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H27NO7/c1-6-10-28-21(27)29-13(2)18-16(23-19(18)25)12-17(24)14-8-7-9-15(11-14)20(26)30-22(3,4)5/h6-9,11,13,16,18H,1,10,12H2,2-5H3,(H,23,25)/t13-,16-,18-/m1/s1 |
| InChIKey | YLEMPCRUSBLTTR-MZMPZRCHSA-N |
| XLogP | 3.06 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|