C18H27NO2 — CID 115462242
methyl 2-[2-[[[(1R)-1-cyclohexylethyl]amino]methyl]phenyl]acetate (PubChem CID 115462242) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is methyl 2-[2-[[[(1R)-1-cyclohexylethyl]amino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[2-[[[(1R)-1-cyclohexylethyl]amino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 115462242 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | methyl 2-[2-[[[(1R)-1-cyclohexylethyl]amino]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1CN[C@H](C)C1CCCCC1 |
| InChI | InChI=1S/C18H27NO2/c1-14(15-8-4-3-5-9-15)19-13-17-11-7-6-10-16(17)12-18(20)21-2/h6-7,10-11,14-15,19H,3-5,8-9,12-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | YGWGPOOZCWKCNN-CQSZACIVSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |