C23H33NO6 — CID 11546241
ditert-butyl (3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-[(1R)-1-phenylethyl]azetidine-2,2-dicarboxylate (PubChem CID 11546241) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is ditert-butyl (3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-[(1R)-1-phenylethyl]azetidine-2,2-dicarboxylate.
| Compound Name | ditert-butyl (3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-[(1R)-1-phenylethyl]azetidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11546241 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | ditert-butyl (3S)-3-[(1R)-1-hydroxyethyl]-4-oxo-1-[(1R)-1-phenylethyl]azetidine-2,2-dicarboxylate |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@H]([C@@H](C)O)C1(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO6/c1-14(16-12-10-9-11-13-16)24-18(26)17(15(2)25)23(24,19(27)29-21(3,4)5)20(28)30-22(6,7)8/h9-15,17,25H,1-8H3/t14-,15-,17+/m1/s1 |
| InChIKey | SCMHSNFJMMKNOH-INMHGKMJSA-N |
| XLogP | 3.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|