C23H24N4O4 — CID 11546264
diethyl 1,1,2,2-tetracyano-9a-methyl-5-methylidene-3,6,8,9-tetrahydrobenzo[7]annulene-7,7-dicarboxylate (PubChem CID 11546264) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is diethyl 1,1,2,2-tetracyano-9a-methyl-5-methylidene-3,6,8,9-tetrahydrobenzo[7]annulene-7,7-dicarboxylate.
| Compound Name | diethyl 1,1,2,2-tetracyano-9a-methyl-5-methylidene-3,6,8,9-tetrahydrobenzo[7]annulene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 11546264 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | diethyl 1,1,2,2-tetracyano-9a-methyl-5-methylidene-3,6,8,9-tetrahydrobenzo[7]annulene-7,7-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CCC2(C)C1=CCC(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C23H24N4O4/c1-5-30-18(28)22(19(29)31-6-2)10-9-20(4)17(16(3)11-22)7-8-21(12-24,13-25)23(20,14-26)15-27/h7H,3,5-6,8-11H2,1-2,4H3 |
| InChIKey | ZOCTUDBGJFRRDV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 147.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|