C19H22ClF3O5 — CID 11546312
(2S,3R,4R,5S,6S)-2-[4-chloro-3-[4-(difluoromethylidene)cyclohexyl]oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 11546312) has the molecular formula C19H22ClF3O5 and a molecular weight of 422.83 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-[4-(difluoromethylidene)cyclohexyl]oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[4-(difluoromethylidene)cyclohexyl]oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11546312 |
| Molecular Formula | C19H22ClF3O5 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-[4-(difluoromethylidene)cyclohexyl]oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2ccc(Cl)c(OC3CCC(=C(F)F)CC3)c2)O[C@H](CF)[C@H]1O |
| InChI | InChI=1S/C19H22ClF3O5/c20-12-6-3-10(18-17(26)16(25)15(24)14(8-21)28-18)7-13(12)27-11-4-1-9(2-5-11)19(22)23/h3,6-7,11,14-18,24-26H,1-2,4-5,8H2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | LSHIWWWAJIBVBD-SFFUCWETSA-N |
| XLogP | 3.30 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |