About 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid
4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid (PubChem CID 11546331) has the molecular formula C23H25N3O3S
and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid.
Molecular Properties
| Compound Name | 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid |
| PubChem CID | 11546331 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid |
| SMILES | COc1ccc2c(c1)nc(SCCCC(=O)O)n2Cc1cn(C)c2cccc(C)c12 |
| InChI | InChI=1S/C23H25N3O3S/c1-15-6-4-7-20-22(15)16(13-25(20)2)14-26-19-10-9-17(29-3)12-18(19)24-23(26)30-11-5-8-21(27)28/h4,6-7,9-10,12-13H,5,8,11,14H2,1-3H3,(H,27,28) |
| InChIKey | DETSQGNXKGMAII-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid?
The IUPAC name of 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid (CID 11546331) is 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid.
What is the SMILES notation for 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid?
The canonical SMILES for 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid is COc1ccc2c(c1)nc(SCCCC(=O)O)n2Cc1cn(C)c2cccc(C)c12.
What is the InChIKey of 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid?
The InChIKey is DETSQGNXKGMAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O3S/c1-15-6-4-7-20-22(15)16(13-25(20)2)14-26-19-10-9-17(29-3)12-18(19)24-23(26)30-11-5-8-21(27)28/h4,6-7,9-10,12-13H,5,8,11,14H2,1-3H3,(H,27,28).
What are the key properties of 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid?
4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid has a molecular weight of 423.54 g/mol, XLogP of 4.85, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(1,4-dimethylindol-3-yl)methyl]-5-methoxybenzimidazol-2-yl]sulfanylbutanoic acid is sourced from PubChem (CID 11546331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).