C21H15N9O2 — CID 11546358
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-quinolin-2-ylurea (PubChem CID 11546358) has the molecular formula C21H15N9O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-quinolin-2-ylurea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-quinolin-2-ylurea |
|---|---|
| PubChem CID | 11546358 |
| Molecular Formula | C21H15N9O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-quinolin-2-ylurea |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc4ccccc4n3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H15N9O2/c1-29-11-13-17(27-29)25-20(30-19(13)24-18(28-30)15-7-4-10-32-15)26-21(31)23-16-9-8-12-5-2-3-6-14(12)22-16/h2-11H,1H3,(H2,22,23,25,26,27,31) |
| InChIKey | GOHBLZKJZRMREF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |